C12H23ClN4 — CID 120780625
[1-[(1-ethylpyrazol-4-yl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120780625) has the molecular formula C12H23ClN4 and a molecular weight of 258.80 g/mol. Its IUPAC name is [1-[(1-ethylpyrazol-4-yl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[(1-ethylpyrazol-4-yl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120780625 |
| Molecular Formula | C12H23ClN4 |
| Molecular Weight | 258.80 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | [1-[(1-ethylpyrazol-4-yl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CCn1cc(CN2CCC(C)(CN)C2)cn1.Cl |
| InChI | InChI=1S/C12H22N4.ClH/c1-3-16-8-11(6-14-16)7-15-5-4-12(2,9-13)10-15;/h6,8H,3-5,7,9-10,13H2,1-2H3;1H |
| InChIKey | SPEWOOWWBJIBMH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.80 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |