C12H13F4NO — CID 178059830
4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine (PubChem CID 178059830) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine.
| Compound Name | 4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 178059830 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine |
| SMILES | Fc1cc(CN2CCOCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F4NO/c13-11-6-9(5-10(7-11)12(14,15)16)8-17-1-3-18-4-2-17/h5-7H,1-4,8H2 |
| InChIKey | GDGRXWPODXICQP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |