C13H16F4N2O — CID 114393433
[4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholin-2-yl]methanamine (PubChem CID 114393433) has the molecular formula C13H16F4N2O and a molecular weight of 292.28 g/mol. Its IUPAC name is [4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholin-2-yl]methanamine.
| Compound Name | [4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 114393433 |
| Molecular Formula | C13H16F4N2O |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | [4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholin-2-yl]methanamine |
| SMILES | NCC1CN(Cc2cc(F)cc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C13H16F4N2O/c14-11-4-9(3-10(5-11)13(15,16)17)7-19-1-2-20-12(6-18)8-19/h3-5,12H,1-2,6-8,18H2 |
| InChIKey | VGYDJFIVAMAXAW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |