C12H16Cl2N2O — CID 11346392
[(2R)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine (PubChem CID 11346392) has the molecular formula C12H16Cl2N2O and a molecular weight of 275.18 g/mol. Its IUPAC name is [(2R)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine.
| Compound Name | [(2R)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 11346392 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | [(2R)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine |
| SMILES | NC[C@@H]1CN(Cc2ccc(Cl)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C12H16Cl2N2O/c13-11-2-1-9(5-12(11)14)7-16-3-4-17-10(6-15)8-16/h1-2,5,10H,3-4,6-8,15H2/t10-/m1/s1 |
| InChIKey | UANWWXRZQGYWSR-SNVBAGLBSA-N |
| XLogP | 2.15 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |