C13H18Cl2N2O — CID 81490139
1-[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]ethanamine (PubChem CID 81490139) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is 1-[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]ethanamine.
| Compound Name | 1-[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]ethanamine |
|---|---|
| PubChem CID | 81490139 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]ethanamine |
| SMILES | CC(N)C1CN(Cc2ccc(Cl)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C13H18Cl2N2O/c1-9(16)13-8-17(4-5-18-13)7-10-2-3-11(14)12(15)6-10/h2-3,6,9,13H,4-5,7-8,16H2,1H3 |
| InChIKey | GNIULJJTUXMNIN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |