C13H15Cl2NO — CID 102352345
(2S)-4-[(3,4-dichlorophenyl)methyl]-2-ethenylmorpholine (PubChem CID 102352345) has the molecular formula C13H15Cl2NO and a molecular weight of 272.18 g/mol. Its IUPAC name is (2S)-4-[(3,4-dichlorophenyl)methyl]-2-ethenylmorpholine.
| Compound Name | (2S)-4-[(3,4-dichlorophenyl)methyl]-2-ethenylmorpholine |
|---|---|
| PubChem CID | 102352345 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | (2S)-4-[(3,4-dichlorophenyl)methyl]-2-ethenylmorpholine |
| SMILES | C=C[C@H]1CN(Cc2ccc(Cl)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C13H15Cl2NO/c1-2-11-9-16(5-6-17-11)8-10-3-4-12(14)13(15)7-10/h2-4,7,11H,1,5-6,8-9H2/t11-/m0/s1 |
| InChIKey | AZGKPUKNDVWCLI-NSHDSACASA-N |
| XLogP | 3.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|