C16H21Cl2N3O2 — CID 10109024
1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-prop-2-enylurea (PubChem CID 10109024) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-prop-2-enylurea.
| Compound Name | 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 10109024 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NCC1CN(Cc2ccc(Cl)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C16H21Cl2N3O2/c1-2-5-19-16(22)20-9-13-11-21(6-7-23-13)10-12-3-4-14(17)15(18)8-12/h2-4,8,13H,1,5-7,9-11H2,(H2,19,20,22) |
| InChIKey | GHXSIYFEJJQTHU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|