C19H24Cl3N5O4 — CID 69059363
1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[[4-(hydrazinecarbonyl)furan-2-yl]methyl]urea;hydrochloride (PubChem CID 69059363) has the molecular formula C19H24Cl3N5O4 and a molecular weight of 492.79 g/mol. Its IUPAC name is 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[[4-(hydrazinecarbonyl)furan-2-yl]methyl]urea;hydrochloride.
| Compound Name | 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[[4-(hydrazinecarbonyl)furan-2-yl]methyl]urea;hydrochloride |
|---|---|
| PubChem CID | 69059363 |
| Molecular Formula | C19H24Cl3N5O4 |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[[4-(hydrazinecarbonyl)furan-2-yl]methyl]urea;hydrochloride |
| SMILES | Cl.NNC(=O)c1coc(CNC(=O)NCC2CN(Cc3ccc(Cl)c(Cl)c3)CCO2)c1 |
| InChI | InChI=1S/C19H23Cl2N5O4.ClH/c20-16-2-1-12(5-17(16)21)9-26-3-4-29-15(10-26)8-24-19(28)23-7-14-6-13(11-30-14)18(27)25-22;/h1-2,5-6,11,15H,3-4,7-10,22H2,(H,25,27)(H2,23,24,28);1H |
| InChIKey | KDICWNXUQADMTF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|