C20H23ClIN3O2 — CID 10278623
1-[(4-chlorophenyl)methyl]-3-[[4-[(3-iodophenyl)methyl]morpholin-2-yl]methyl]urea (PubChem CID 10278623) has the molecular formula C20H23ClIN3O2 and a molecular weight of 499.78 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[[4-[(3-iodophenyl)methyl]morpholin-2-yl]methyl]urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[[4-[(3-iodophenyl)methyl]morpholin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 10278623 |
| Molecular Formula | C20H23ClIN3O2 |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[[4-[(3-iodophenyl)methyl]morpholin-2-yl]methyl]urea |
| SMILES | O=C(NCc1ccc(Cl)cc1)NCC1CN(Cc2cccc(I)c2)CCO1 |
| InChI | InChI=1S/C20H23ClIN3O2/c21-17-6-4-15(5-7-17)11-23-20(26)24-12-19-14-25(8-9-27-19)13-16-2-1-3-18(22)10-16/h1-7,10,19H,8-9,11-14H2,(H2,23,24,26) |
| InChIKey | MZFOOLSSGQPJOZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|