C19H27Cl2N3O2 — CID 10272298
1-cyclohexyl-3-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]urea (PubChem CID 10272298) has the molecular formula C19H27Cl2N3O2 and a molecular weight of 400.35 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]urea.
| Compound Name | 1-cyclohexyl-3-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 10272298 |
| Molecular Formula | C19H27Cl2N3O2 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-cyclohexyl-3-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]urea |
| SMILES | O=C(NCC1CN(Cc2ccc(Cl)c(Cl)c2)CCO1)NC1CCCCC1 |
| InChI | InChI=1S/C19H27Cl2N3O2/c20-17-7-6-14(10-18(17)21)12-24-8-9-26-16(13-24)11-22-19(25)23-15-4-2-1-3-5-15/h6-7,10,15-16H,1-5,8-9,11-13H2,(H2,22,23,25) |
| InChIKey | DEIWIHSUCRYIQL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |