C20H23Cl2N3O2S — CID 67168644
2-(4-aminophenyl)sulfanyl-N-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]acetamide (PubChem CID 67168644) has the molecular formula C20H23Cl2N3O2S and a molecular weight of 440.40 g/mol. Its IUPAC name is 2-(4-aminophenyl)sulfanyl-N-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]acetamide.
| Compound Name | 2-(4-aminophenyl)sulfanyl-N-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 67168644 |
| Molecular Formula | C20H23Cl2N3O2S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-(4-aminophenyl)sulfanyl-N-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]acetamide |
| SMILES | Nc1ccc(SCC(=O)NCC2CN(Cc3ccc(Cl)c(Cl)c3)CCO2)cc1 |
| InChI | InChI=1S/C20H23Cl2N3O2S/c21-18-6-1-14(9-19(18)22)11-25-7-8-27-16(12-25)10-24-20(26)13-28-17-4-2-15(23)3-5-17/h1-6,9,16H,7-8,10-13,23H2,(H,24,26) |
| InChIKey | CLWGOJRKEHSRNO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|