C21H22Cl2N4O2S2 — CID 67170691
2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]acetamide (PubChem CID 67170691) has the molecular formula C21H22Cl2N4O2S2 and a molecular weight of 497.47 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]acetamide.
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 67170691 |
| Molecular Formula | C21H22Cl2N4O2S2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]acetamide |
| SMILES | Nc1ccc2nc(SCC(=O)NCC3CN(Cc4ccc(Cl)c(Cl)c4)CCO3)sc2c1 |
| InChI | InChI=1S/C21H22Cl2N4O2S2/c22-16-3-1-13(7-17(16)23)10-27-5-6-29-15(11-27)9-25-20(28)12-30-21-26-18-4-2-14(24)8-19(18)31-21/h1-4,7-8,15H,5-6,9-12,24H2,(H,25,28) |
| InChIKey | OMPCXFIIGIOHFO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|