C20H24Cl2N4O2S2 — CID 67169253
N-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-2-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-ylsulfanyl)acetamide (PubChem CID 67169253) has the molecular formula C20H24Cl2N4O2S2 and a molecular weight of 487.48 g/mol. Its IUPAC name is N-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-2-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-ylsulfanyl)acetamide.
| Compound Name | N-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-2-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 67169253 |
| Molecular Formula | C20H24Cl2N4O2S2 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | N-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-2-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nc2c(s1)CNCC2)NCC1CN(Cc2ccc(Cl)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C20H24Cl2N4O2S2/c21-15-2-1-13(7-16(15)22)10-26-5-6-28-14(11-26)8-24-19(27)12-29-20-25-17-3-4-23-9-18(17)30-20/h1-2,7,14,23H,3-6,8-12H2,(H,24,27) |
| InChIKey | XMZWQENWTOKDEC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |