C18H19Cl2NO2 — CID 127031497
(2S)-4-[(3,4-dichlorophenyl)methyl]-2-(phenoxymethyl)morpholine (PubChem CID 127031497) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is (2S)-4-[(3,4-dichlorophenyl)methyl]-2-(phenoxymethyl)morpholine.
| Compound Name | (2S)-4-[(3,4-dichlorophenyl)methyl]-2-(phenoxymethyl)morpholine |
|---|---|
| PubChem CID | 127031497 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (2S)-4-[(3,4-dichlorophenyl)methyl]-2-(phenoxymethyl)morpholine |
| SMILES | Clc1ccc(CN2CCO[C@H](COc3ccccc3)C2)cc1Cl |
| InChI | InChI=1S/C18H19Cl2NO2/c19-17-7-6-14(10-18(17)20)11-21-8-9-22-16(12-21)13-23-15-4-2-1-3-5-15/h1-7,10,16H,8-9,11-13H2/t16-/m0/s1 |
| InChIKey | HFYVRKRSPDIIGS-INIZCTEOSA-N |
| XLogP | 4.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |