C13H16F4N2 — CID 103575425
1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-methylpyrrolidin-3-amine (PubChem CID 103575425) has the molecular formula C13H16F4N2 and a molecular weight of 276.28 g/mol. Its IUPAC name is 1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-methylpyrrolidin-3-amine.
| Compound Name | 1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 103575425 |
| Molecular Formula | C13H16F4N2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-methylpyrrolidin-3-amine |
| SMILES | CC1CN(Cc2cc(F)cc(C(F)(F)F)c2)CC1N |
| InChI | InChI=1S/C13H16F4N2/c1-8-5-19(7-12(8)18)6-9-2-10(13(15,16)17)4-11(14)3-9/h2-4,8,12H,5-7,18H2,1H3 |
| InChIKey | UBCFBBHITFMOKX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |