C12H17FN2 — CID 103575513
1-[(4-fluorophenyl)methyl]-4-methylpyrrolidin-3-amine (PubChem CID 103575513) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-4-methylpyrrolidin-3-amine.
| Compound Name | 1-[(4-fluorophenyl)methyl]-4-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 103575513 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-4-methylpyrrolidin-3-amine |
| SMILES | CC1CN(Cc2ccc(F)cc2)CC1N |
| InChI | InChI=1S/C12H17FN2/c1-9-6-15(8-12(9)14)7-10-2-4-11(13)5-3-10/h2-5,9,12H,6-8,14H2,1H3 |
| InChIKey | MXZOAKRHKAOENR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |