About 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine
1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine (PubChem CID 178060005) has the molecular formula C20H20F4N2O2
and a molecular weight of 396.38 g/mol. Its IUPAC name is 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine.
Molecular Properties
| Compound Name | 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine |
| PubChem CID | 178060005 |
| Molecular Formula | C20H20F4N2O2 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine |
| SMILES | Fc1cc(CN2CCOCC2)cc(C(F)(F)F)c1.O=C1Cc2ccccc2N1 |
| InChI | InChI=1S/C12H13F4NO.C8H7NO/c13-11-6-9(5-10(7-11)12(14,15)16)8-17-1-3-18-4-2-17;10-8-5-6-3-1-2-4-7(6)9-8/h5-7H,1-4,8H2;1-4H,5H2,(H,9,10) |
| InChIKey | FATTZHPHLXLZJQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine?
The IUPAC name of 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine (CID 178060005) is 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine.
What is the SMILES notation for 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine?
The canonical SMILES for 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine is Fc1cc(CN2CCOCC2)cc(C(F)(F)F)c1.O=C1Cc2ccccc2N1.
What is the InChIKey of 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine?
The InChIKey is FATTZHPHLXLZJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F4NO.C8H7NO/c13-11-6-9(5-10(7-11)12(14,15)16)8-17-1-3-18-4-2-17;10-8-5-6-3-1-2-4-7(6)9-8/h5-7H,1-4,8H2;1-4H,5H2,(H,9,10).
What are the key properties of 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine?
1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine has a molecular weight of 396.38 g/mol, XLogP of 3.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroindol-2-one;4-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]morpholine is sourced from PubChem (CID 178060005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).