C19H31NO — CID 59709271
4-[(3,5-ditert-butylphenyl)methyl]morpholine (PubChem CID 59709271) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 4-[(3,5-ditert-butylphenyl)methyl]morpholine.
| Compound Name | 4-[(3,5-ditert-butylphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 59709271 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 4-[(3,5-ditert-butylphenyl)methyl]morpholine |
| SMILES | CC(C)(C)c1cc(CN2CCOCC2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H31NO/c1-18(2,3)16-11-15(12-17(13-16)19(4,5)6)14-20-7-9-21-10-8-20/h11-13H,7-10,14H2,1-6H3 |
| InChIKey | XBAWRFLOJXYFBD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |