C42H72N4 — CID 132917367
1,8-bis[(3,5-ditert-butylphenyl)methyl]-4,11-dimethyl-1,4,8,11-tetrazacyclotetradecane (PubChem CID 132917367) has the molecular formula C42H72N4 and a molecular weight of 633.07 g/mol. Its IUPAC name is 1,8-bis[(3,5-ditert-butylphenyl)methyl]-4,11-dimethyl-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1,8-bis[(3,5-ditert-butylphenyl)methyl]-4,11-dimethyl-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 132917367 |
| Molecular Formula | C42H72N4 |
| Molecular Weight | 633.07 g/mol |
| Exact Mass | 632.58 |
| IUPAC Name | 1,8-bis[(3,5-ditert-butylphenyl)methyl]-4,11-dimethyl-1,4,8,11-tetrazacyclotetradecane |
| SMILES | CN1CCCN(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)CCN(C)CCCN(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C42H72N4/c1-39(2,3)35-25-33(26-36(29-35)40(4,5)6)31-45-19-15-17-44(14)22-24-46(20-16-18-43(13)21-23-45)32-34-27-37(41(7,8)9)30-38(28-34)42(10,11)12/h25-30H,15-24,31-32H2,1-14H3 |
| InChIKey | QNFDYXKQXTVFBO-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.07 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |