2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid

C15H22N2O2 — CID 105345632

IUPAC2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid
SMILESCN1CCCN(Cc2ccc(CC(=O)O)cc2)CC1
InChIInChI=1S/C15H22N2O2/c1-16-7-2-8-17(10-9-16)12-14-5-3-13(4-6-14)11-15(18)19/h3-6H,2,7-12H2,1H3,(H,18,19)
InChIKeyZFIMZYGJVJKXRR-UHFFFAOYSA-N
MW262.35 g/mol
LogP1.45
Rot. Bonds4

About 2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid

2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid (PubChem CID 105345632) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid.

Molecular Properties

Compound Name2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid
PubChem CID105345632
Molecular FormulaC15H22N2O2
Molecular Weight262.35 g/mol
Exact Mass262.17
IUPAC Name2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid
SMILESCN1CCCN(Cc2ccc(CC(=O)O)cc2)CC1
InChIInChI=1S/C15H22N2O2/c1-16-7-2-8-17(10-9-16)12-14-5-3-13(4-6-14)11-15(18)19/h3-6H,2,7-12H2,1H3,(H,18,19)
InChIKeyZFIMZYGJVJKXRR-UHFFFAOYSA-N
XLogP1.45
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.35
LogP ≤ 51.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid?
The IUPAC name of 2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid (CID 105345632) is 2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid.
What is the SMILES notation for 2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid?
The canonical SMILES for 2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid is CN1CCCN(Cc2ccc(CC(=O)O)cc2)CC1.
What is the InChIKey of 2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid?
The InChIKey is ZFIMZYGJVJKXRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-16-7-2-8-17(10-9-16)12-14-5-3-13(4-6-14)11-15(18)19/h3-6H,2,7-12H2,1H3,(H,18,19).
What are the key properties of 2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid?
2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid has a molecular weight of 262.35 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]acetic acid is sourced from PubChem (CID 105345632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).