C13H17NO4S — CID 105345699
2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]acetic acid (PubChem CID 105345699) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 105345699 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CN2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C13H17NO4S/c15-13(16)9-11-1-3-12(4-2-11)10-14-5-7-19(17,18)8-6-14/h1-4H,5-10H2,(H,15,16) |
| InChIKey | RCQVFTLRBDVTKC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |