C25H32BNO5S — CID 123895494
1-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (PubChem CID 123895494) has the molecular formula C25H32BNO5S and a molecular weight of 469.41 g/mol. Its IUPAC name is 1-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone.
| Compound Name | 1-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 123895494 |
| Molecular Formula | C25H32BNO5S |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 1-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| SMILES | CC1(C)OB(c2ccc(CC(=O)c3ccc(CN4CCS(=O)(=O)CC4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C25H32BNO5S/c1-24(2)25(3,4)32-26(31-24)22-11-7-19(8-12-22)17-23(28)21-9-5-20(6-10-21)18-27-13-15-33(29,30)16-14-27/h5-12H,13-18H2,1-4H3 |
| InChIKey | DSUDPVLQNYIDSS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|