C21H25BO3 — CID 58677932
1-phenyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-one (PubChem CID 58677932) has the molecular formula C21H25BO3 and a molecular weight of 336.24 g/mol. Its IUPAC name is 1-phenyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-one.
| Compound Name | 1-phenyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 58677932 |
| Molecular Formula | C21H25BO3 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 1-phenyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-one |
| SMILES | CC1(C)OB(c2ccc(CCC(=O)c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C21H25BO3/c1-20(2)21(3,4)25-22(24-20)18-13-10-16(11-14-18)12-15-19(23)17-8-6-5-7-9-17/h5-11,13-14H,12,15H2,1-4H3 |
| InChIKey | XKUPTXQQGHKGQM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|