C20H29BN2O3 — CID 143929898
ethane;3-phenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-one (PubChem CID 143929898) has the molecular formula C20H29BN2O3 and a molecular weight of 356.28 g/mol. Its IUPAC name is ethane;3-phenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-one.
| Compound Name | ethane;3-phenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-one |
|---|---|
| PubChem CID | 143929898 |
| Molecular Formula | C20H29BN2O3 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | ethane;3-phenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-one |
| SMILES | CC.CC1(C)OB(c2cnn(C(=O)CCc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C18H23BN2O3.C2H6/c1-17(2)18(3,4)24-19(23-17)15-12-20-21(13-15)16(22)11-10-14-8-6-5-7-9-14;1-2/h5-9,12-13H,10-11H2,1-4H3;1-2H3 |
| InChIKey | YTGIRRIIDQLYDT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|