C13H21BN2O4 — CID 131750013
2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoic acid (PubChem CID 131750013) has the molecular formula C13H21BN2O4 and a molecular weight of 280.13 g/mol. Its IUPAC name is 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoic acid.
| Compound Name | 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 131750013 |
| Molecular Formula | C13H21BN2O4 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoic acid |
| SMILES | CC(C)(C(=O)O)n1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C13H21BN2O4/c1-11(2,10(17)18)16-8-9(7-15-16)14-19-12(3,4)13(5,6)20-14/h7-8H,1-6H3,(H,17,18) |
| InChIKey | ROFVWRPVNLAICQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|