C19H26BN3O3 — CID 166495195
N,N-dimethyl-2-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetamide (PubChem CID 166495195) has the molecular formula C19H26BN3O3 and a molecular weight of 355.25 g/mol. Its IUPAC name is N,N-dimethyl-2-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 166495195 |
| Molecular Formula | C19H26BN3O3 |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N,N-dimethyl-2-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetamide |
| SMILES | CN(C)C(=O)C(c1ccccc1)n1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C19H26BN3O3/c1-18(2)19(3,4)26-20(25-18)15-12-21-23(13-15)16(17(24)22(5)6)14-10-8-7-9-11-14/h7-13,16H,1-6H3 |
| InChIKey | IZEASAKEBCIUHC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|