C19H23BO3 — CID 99773699
(S)-phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (PubChem CID 99773699) has the molecular formula C19H23BO3 and a molecular weight of 310.20 g/mol. Its IUPAC name is (S)-phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol.
| Compound Name | (S)-phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 99773699 |
| Molecular Formula | C19H23BO3 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (S)-phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| SMILES | CC1(C)OB(c2cccc([C@@H](O)c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C19H23BO3/c1-18(2)19(3,4)23-20(22-18)16-12-8-11-15(13-16)17(21)14-9-6-5-7-10-14/h5-13,17,21H,1-4H3/t17-/m0/s1 |
| InChIKey | SPSDOGOXXYFZLF-KRWDZBQOSA-N |
| XLogP | 3.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|