C15H22BNO4 — CID 69316253
1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylcarbamic acid (PubChem CID 69316253) has the molecular formula C15H22BNO4 and a molecular weight of 291.16 g/mol. Its IUPAC name is 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylcarbamic acid.
| Compound Name | 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylcarbamic acid |
|---|---|
| PubChem CID | 69316253 |
| Molecular Formula | C15H22BNO4 |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylcarbamic acid |
| SMILES | CC(NC(=O)O)c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C15H22BNO4/c1-10(17-13(18)19)11-7-6-8-12(9-11)16-20-14(2,3)15(4,5)21-16/h6-10,17H,1-5H3,(H,18,19) |
| InChIKey | ZIORYBXYHVMMTC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|