C15H22BNO5 — CID 141435206
2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethylcarbamic acid (PubChem CID 141435206) has the molecular formula C15H22BNO5 and a molecular weight of 307.16 g/mol. Its IUPAC name is 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethylcarbamic acid.
| Compound Name | 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 141435206 |
| Molecular Formula | C15H22BNO5 |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethylcarbamic acid |
| SMILES | CC1(C)OB(c2cccc(OCCNC(=O)O)c2)OC1(C)C |
| InChI | InChI=1S/C15H22BNO5/c1-14(2)15(3,4)22-16(21-14)11-6-5-7-12(10-11)20-9-8-17-13(18)19/h5-7,10,17H,8-9H2,1-4H3,(H,18,19) |
| InChIKey | QNYATTZFCXITJG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|