C19H31BN2O6 — CID 68978955
tert-butyl carbamate;[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylcarbamic acid (PubChem CID 68978955) has the molecular formula C19H31BN2O6 and a molecular weight of 394.28 g/mol. Its IUPAC name is tert-butyl carbamate;[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylcarbamic acid.
| Compound Name | tert-butyl carbamate;[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 68978955 |
| Molecular Formula | C19H31BN2O6 |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | tert-butyl carbamate;[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylcarbamic acid |
| SMILES | CC(C)(C)OC(N)=O.CC1(C)OB(c2cccc(CNC(=O)O)c2)OC1(C)C |
| InChI | InChI=1S/C14H20BNO4.C5H11NO2/c1-13(2)14(3,4)20-15(19-13)11-7-5-6-10(8-11)9-16-12(17)18;1-5(2,3)8-4(6)7/h5-8,16H,9H2,1-4H3,(H,17,18);1-3H3,(H2,6,7) |
| InChIKey | ODLCRWSNFXRCSE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|