C18H28BNO4 — CID 123669329
2-methyl-2-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylamino]propanoic acid (PubChem CID 123669329) has the molecular formula C18H28BNO4 and a molecular weight of 333.24 g/mol. Its IUPAC name is 2-methyl-2-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylamino]propanoic acid.
| Compound Name | 2-methyl-2-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 123669329 |
| Molecular Formula | C18H28BNO4 |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 2-methyl-2-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylamino]propanoic acid |
| SMILES | CC(C)(NCCc1cccc(B2OC(C)(C)C(C)(C)O2)c1)C(=O)O |
| InChI | InChI=1S/C18H28BNO4/c1-16(2,15(21)22)20-11-10-13-8-7-9-14(12-13)19-23-17(3,4)18(5,6)24-19/h7-9,12,20H,10-11H2,1-6H3,(H,21,22) |
| InChIKey | VICYQHGYQOUROC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|