C17H29BN2O2 — CID 145047359
N,N'-dimethyl-N'-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]ethane-1,2-diamine (PubChem CID 145047359) has the molecular formula C17H29BN2O2 and a molecular weight of 304.24 g/mol. Its IUPAC name is N,N'-dimethyl-N'-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N,N'-dimethyl-N'-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 145047359 |
| Molecular Formula | C17H29BN2O2 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | N,N'-dimethyl-N'-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]ethane-1,2-diamine |
| SMILES | CNCCN(C)Cc1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C17H29BN2O2/c1-16(2)17(3,4)22-18(21-16)15-9-7-8-14(12-15)13-20(6)11-10-19-5/h7-9,12,19H,10-11,13H2,1-6H3 |
| InChIKey | GLLADLMYRVUYTM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|