C14H23ClN2 — CID 62428888
N'-[(3-chlorophenyl)methyl]-N,N'-dimethylpentane-1,5-diamine (PubChem CID 62428888) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is N'-[(3-chlorophenyl)methyl]-N,N'-dimethylpentane-1,5-diamine.
| Compound Name | N'-[(3-chlorophenyl)methyl]-N,N'-dimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 62428888 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N'-[(3-chlorophenyl)methyl]-N,N'-dimethylpentane-1,5-diamine |
| SMILES | CNCCCCCN(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H23ClN2/c1-16-9-4-3-5-10-17(2)12-13-7-6-8-14(15)11-13/h6-8,11,16H,3-5,9-10,12H2,1-2H3 |
| InChIKey | IUHGWDRHNIBYLF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|