C22H26Cl2N2O2 — CID 118729302
2-[6-[(3-chlorophenyl)methyl-methylamino]hexyl]isoindole-1,3-dione;hydrochloride (PubChem CID 118729302) has the molecular formula C22H26Cl2N2O2 and a molecular weight of 421.37 g/mol. Its IUPAC name is 2-[6-[(3-chlorophenyl)methyl-methylamino]hexyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[6-[(3-chlorophenyl)methyl-methylamino]hexyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 118729302 |
| Molecular Formula | C22H26Cl2N2O2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-[6-[(3-chlorophenyl)methyl-methylamino]hexyl]isoindole-1,3-dione;hydrochloride |
| SMILES | CN(CCCCCCN1C(=O)c2ccccc2C1=O)Cc1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C22H25ClN2O2.ClH/c1-24(16-17-9-8-10-18(23)15-17)13-6-2-3-7-14-25-21(26)19-11-4-5-12-20(19)22(25)27;/h4-5,8-12,15H,2-3,6-7,13-14,16H2,1H3;1H |
| InChIKey | CUSLOPYXRUYXIT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|