C25H20ClNO2 — CID 68941009
2-[3-[3-[(Z)-2-(3-chlorophenyl)ethenyl]phenyl]propyl]isoindole-1,3-dione (PubChem CID 68941009) has the molecular formula C25H20ClNO2 and a molecular weight of 401.89 g/mol. Its IUPAC name is 2-[3-[3-[(Z)-2-(3-chlorophenyl)ethenyl]phenyl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[3-[(Z)-2-(3-chlorophenyl)ethenyl]phenyl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 68941009 |
| Molecular Formula | C25H20ClNO2 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-[3-[3-[(Z)-2-(3-chlorophenyl)ethenyl]phenyl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCc1cccc(/C=C\c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C25H20ClNO2/c26-21-10-4-8-20(17-21)14-13-19-7-3-6-18(16-19)9-5-15-27-24(28)22-11-1-2-12-23(22)25(27)29/h1-4,6-8,10-14,16-17H,5,9,15H2/b14-13- |
| InChIKey | LRHCBABSOTUPPE-YPKPFQOOSA-N |
| XLogP | 5.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|