C27H25NO2 — CID 68944362
2-[3-[3-[2-(3,5-dimethylphenyl)ethenyl]phenyl]propyl]isoindole-1,3-dione (PubChem CID 68944362) has the molecular formula C27H25NO2 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[3-[3-[2-(3,5-dimethylphenyl)ethenyl]phenyl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[3-[2-(3,5-dimethylphenyl)ethenyl]phenyl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 68944362 |
| Molecular Formula | C27H25NO2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 2-[3-[3-[2-(3,5-dimethylphenyl)ethenyl]phenyl]propyl]isoindole-1,3-dione |
| SMILES | Cc1cc(C)cc(C=Cc2cccc(CCCN3C(=O)c4ccccc4C3=O)c2)c1 |
| InChI | InChI=1S/C27H25NO2/c1-19-15-20(2)17-23(16-19)13-12-22-8-5-7-21(18-22)9-6-14-28-26(29)24-10-3-4-11-25(24)27(28)30/h3-5,7-8,10-13,15-18H,6,9,14H2,1-2H3 |
| InChIKey | XGFHOLADZKMQTC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|