C28H27NO2 — CID 68937290
2-[3-[3-[2-(2-propan-2-ylphenyl)ethenyl]phenyl]propyl]isoindole-1,3-dione (PubChem CID 68937290) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[3-[3-[2-(2-propan-2-ylphenyl)ethenyl]phenyl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[3-[2-(2-propan-2-ylphenyl)ethenyl]phenyl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 68937290 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-[3-[3-[2-(2-propan-2-ylphenyl)ethenyl]phenyl]propyl]isoindole-1,3-dione |
| SMILES | CC(C)c1ccccc1C=Cc1cccc(CCCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C28H27NO2/c1-20(2)24-13-4-3-12-23(24)17-16-22-10-7-9-21(19-22)11-8-18-29-27(30)25-14-5-6-15-26(25)28(29)31/h3-7,9-10,12-17,19-20H,8,11,18H2,1-2H3 |
| InChIKey | RTZSRWHIHQPLEZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|