C29H45NO2Sn — CID 171374663
CID 171374663 (PubChem CID 171374663) has the molecular formula C29H45NO2Sn and a molecular weight of 558.40 g/mol.
| Compound Name | CID 171374663 |
|---|---|
| PubChem CID | 171374663 |
| Molecular Formula | C29H45NO2Sn |
| Molecular Weight | 558.40 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | — |
| SMILES | CCCC.CCCC.CCCC.O=C1c2ccccc2C(=O)N1CCCc1ccccc1.[Sn] |
| InChI | InChI=1S/C17H15NO2.3C4H10.Sn/c19-16-14-10-4-5-11-15(14)17(20)18(16)12-6-9-13-7-2-1-3-8-13;3*1-3-4-2;/h1-5,7-8,10-11H,6,9,12H2;3*3-4H2,1-2H3; |
| InChIKey | CMVXEKPPSXEWMO-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.40 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|