C16H23ClN2 — CID 106709872
6-[(3-chlorophenyl)methyl-methylamino]-2,2-dimethylhexanenitrile (PubChem CID 106709872) has the molecular formula C16H23ClN2 and a molecular weight of 278.83 g/mol. Its IUPAC name is 6-[(3-chlorophenyl)methyl-methylamino]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[(3-chlorophenyl)methyl-methylamino]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709872 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 6-[(3-chlorophenyl)methyl-methylamino]-2,2-dimethylhexanenitrile |
| SMILES | CN(CCCCC(C)(C)C#N)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H23ClN2/c1-16(2,13-18)9-4-5-10-19(3)12-14-7-6-8-15(17)11-14/h6-8,11H,4-5,9-10,12H2,1-3H3 |
| InChIKey | XPDBMAALRKNXGE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|