C17H26N2 — CID 106709869
2,2-dimethyl-6-[methyl-[(2-methylphenyl)methyl]amino]hexanenitrile (PubChem CID 106709869) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2,2-dimethyl-6-[methyl-[(2-methylphenyl)methyl]amino]hexanenitrile.
| Compound Name | 2,2-dimethyl-6-[methyl-[(2-methylphenyl)methyl]amino]hexanenitrile |
|---|---|
| PubChem CID | 106709869 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2,2-dimethyl-6-[methyl-[(2-methylphenyl)methyl]amino]hexanenitrile |
| SMILES | Cc1ccccc1CN(C)CCCCC(C)(C)C#N |
| InChI | InChI=1S/C17H26N2/c1-15-9-5-6-10-16(15)13-19(4)12-8-7-11-17(2,3)14-18/h5-6,9-10H,7-8,11-13H2,1-4H3 |
| InChIKey | HEBDQFPXQBRSHU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|