C14H24N2 — CID 61411427
N-ethyl-N'-methyl-N'-[(2-methylphenyl)methyl]propane-1,3-diamine (PubChem CID 61411427) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N-ethyl-N'-methyl-N'-[(2-methylphenyl)methyl]propane-1,3-diamine.
| Compound Name | N-ethyl-N'-methyl-N'-[(2-methylphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 61411427 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-ethyl-N'-methyl-N'-[(2-methylphenyl)methyl]propane-1,3-diamine |
| SMILES | CCNCCCN(C)Cc1ccccc1C |
| InChI | InChI=1S/C14H24N2/c1-4-15-10-7-11-16(3)12-14-9-6-5-8-13(14)2/h5-6,8-9,15H,4,7,10-12H2,1-3H3 |
| InChIKey | QQJZFRJJTMLZCR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|