C15H25ClN2 — CID 62412963
N'-[(2-chlorophenyl)methyl]-N-ethyl-N'-methylpentane-1,5-diamine (PubChem CID 62412963) has the molecular formula C15H25ClN2 and a molecular weight of 268.83 g/mol. Its IUPAC name is N'-[(2-chlorophenyl)methyl]-N-ethyl-N'-methylpentane-1,5-diamine.
| Compound Name | N'-[(2-chlorophenyl)methyl]-N-ethyl-N'-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 62412963 |
| Molecular Formula | C15H25ClN2 |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N'-[(2-chlorophenyl)methyl]-N-ethyl-N'-methylpentane-1,5-diamine |
| SMILES | CCNCCCCCN(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C15H25ClN2/c1-3-17-11-7-4-8-12-18(2)13-14-9-5-6-10-15(14)16/h5-6,9-10,17H,3-4,7-8,11-13H2,1-2H3 |
| InChIKey | UORRTMTWUVPMPV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|