C13H16ClN — CID 115872604
N-[(2-chlorophenyl)methyl]-N-methylpent-4-yn-1-amine (PubChem CID 115872604) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-methylpent-4-yn-1-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-methylpent-4-yn-1-amine |
|---|---|
| PubChem CID | 115872604 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-methylpent-4-yn-1-amine |
| SMILES | C#CCCCN(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C13H16ClN/c1-3-4-7-10-15(2)11-12-8-5-6-9-13(12)14/h1,5-6,8-9H,4,7,10-11H2,2H3 |
| InChIKey | WNGOZEGDJFGGFA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|