C14H28N2 — CID 106709964
6-[2,2-dimethylpropyl(methyl)amino]-2,2-dimethylhexanenitrile (PubChem CID 106709964) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 6-[2,2-dimethylpropyl(methyl)amino]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[2,2-dimethylpropyl(methyl)amino]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709964 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 6-[2,2-dimethylpropyl(methyl)amino]-2,2-dimethylhexanenitrile |
| SMILES | CN(CCCCC(C)(C)C#N)CC(C)(C)C |
| InChI | InChI=1S/C14H28N2/c1-13(2,3)12-16(6)10-8-7-9-14(4,5)11-15/h7-10,12H2,1-6H3 |
| InChIKey | FQOJUGVJPWXPGA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|