C14H26N2O — CID 106709849
2,2-dimethyl-6-[methyl(oxan-4-yl)amino]hexanenitrile (PubChem CID 106709849) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 2,2-dimethyl-6-[methyl(oxan-4-yl)amino]hexanenitrile.
| Compound Name | 2,2-dimethyl-6-[methyl(oxan-4-yl)amino]hexanenitrile |
|---|---|
| PubChem CID | 106709849 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 2,2-dimethyl-6-[methyl(oxan-4-yl)amino]hexanenitrile |
| SMILES | CN(CCCCC(C)(C)C#N)C1CCOCC1 |
| InChI | InChI=1S/C14H26N2O/c1-14(2,12-15)8-4-5-9-16(3)13-6-10-17-11-7-13/h13H,4-11H2,1-3H3 |
| InChIKey | IJOXGBWSLIAHKA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|