C10H22N2O — CID 43610795
N'-methyl-N'-(oxan-4-yl)butane-1,4-diamine (PubChem CID 43610795) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is N'-methyl-N'-(oxan-4-yl)butane-1,4-diamine.
| Compound Name | N'-methyl-N'-(oxan-4-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 43610795 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N'-methyl-N'-(oxan-4-yl)butane-1,4-diamine |
| SMILES | CN(CCCCN)C1CCOCC1 |
| InChI | InChI=1S/C10H22N2O/c1-12(7-3-2-6-11)10-4-8-13-9-5-10/h10H,2-9,11H2,1H3 |
| InChIKey | VEOYPKKLNLBMMH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|