C17H27N3 — CID 106712874
6-[(2-aminophenyl)methyl-ethylamino]-2,2-dimethylhexanenitrile (PubChem CID 106712874) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 6-[(2-aminophenyl)methyl-ethylamino]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[(2-aminophenyl)methyl-ethylamino]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106712874 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 6-[(2-aminophenyl)methyl-ethylamino]-2,2-dimethylhexanenitrile |
| SMILES | CCN(CCCCC(C)(C)C#N)Cc1ccccc1N |
| InChI | InChI=1S/C17H27N3/c1-4-20(12-8-7-11-17(2,3)14-18)13-15-9-5-6-10-16(15)19/h5-6,9-10H,4,7-8,11-13,19H2,1-3H3 |
| InChIKey | JKPCJACPAOMTHX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|