C16H25N3 — CID 65252977
4-[(2-aminophenyl)methyl-propan-2-ylamino]-2,2-dimethylbutanenitrile (PubChem CID 65252977) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 4-[(2-aminophenyl)methyl-propan-2-ylamino]-2,2-dimethylbutanenitrile.
| Compound Name | 4-[(2-aminophenyl)methyl-propan-2-ylamino]-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65252977 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 4-[(2-aminophenyl)methyl-propan-2-ylamino]-2,2-dimethylbutanenitrile |
| SMILES | CC(C)N(CCC(C)(C)C#N)Cc1ccccc1N |
| InChI | InChI=1S/C16H25N3/c1-13(2)19(10-9-16(3,4)12-17)11-14-7-5-6-8-15(14)18/h5-8,13H,9-11,18H2,1-4H3 |
| InChIKey | RMDVNRLEKCBUFP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|