C16H26N2S — CID 106709914
2,2-dimethyl-6-[propan-2-yl(thiophen-2-ylmethyl)amino]hexanenitrile (PubChem CID 106709914) has the molecular formula C16H26N2S and a molecular weight of 278.46 g/mol. Its IUPAC name is 2,2-dimethyl-6-[propan-2-yl(thiophen-2-ylmethyl)amino]hexanenitrile.
| Compound Name | 2,2-dimethyl-6-[propan-2-yl(thiophen-2-ylmethyl)amino]hexanenitrile |
|---|---|
| PubChem CID | 106709914 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2,2-dimethyl-6-[propan-2-yl(thiophen-2-ylmethyl)amino]hexanenitrile |
| SMILES | CC(C)N(CCCCC(C)(C)C#N)Cc1cccs1 |
| InChI | InChI=1S/C16H26N2S/c1-14(2)18(12-15-8-7-11-19-15)10-6-5-9-16(3,4)13-17/h7-8,11,14H,5-6,9-10,12H2,1-4H3 |
| InChIKey | ZDYHQZYTQRUNNU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|