C14H26N2S — CID 54946840
N'-propan-2-yl-N'-(thiophen-2-ylmethyl)hexane-1,6-diamine (PubChem CID 54946840) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is N'-propan-2-yl-N'-(thiophen-2-ylmethyl)hexane-1,6-diamine.
| Compound Name | N'-propan-2-yl-N'-(thiophen-2-ylmethyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 54946840 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N'-propan-2-yl-N'-(thiophen-2-ylmethyl)hexane-1,6-diamine |
| SMILES | CC(C)N(CCCCCCN)Cc1cccs1 |
| InChI | InChI=1S/C14H26N2S/c1-13(2)16(10-6-4-3-5-9-15)12-14-8-7-11-17-14/h7-8,11,13H,3-6,9-10,12,15H2,1-2H3 |
| InChIKey | YYXZAFKDLFMKBM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|